C14H18N2O2 — CID 82262244
6-[2-(cyclopentylamino)ethyl]-3H-1,3-benzoxazol-2-one (PubChem CID 82262244) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 6-[2-(cyclopentylamino)ethyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[2-(cyclopentylamino)ethyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 82262244 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 6-[2-(cyclopentylamino)ethyl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2ccc(CCNC3CCCC3)cc2o1 |
| InChI | InChI=1S/C14H18N2O2/c17-14-16-12-6-5-10(9-13(12)18-14)7-8-15-11-3-1-2-4-11/h5-6,9,11,15H,1-4,7-8H2,(H,16,17) |
| InChIKey | RRWMMEIQUBNFBJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |