C23H26F2N2O2 — CID 22669084
6-[4-[4-(3,4-difluorophenyl)butylamino]cyclohexyl]-3H-1,3-benzoxazol-2-one (PubChem CID 22669084) has the molecular formula C23H26F2N2O2 and a molecular weight of 400.47 g/mol. Its IUPAC name is 6-[4-[4-(3,4-difluorophenyl)butylamino]cyclohexyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[4-[4-(3,4-difluorophenyl)butylamino]cyclohexyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 22669084 |
| Molecular Formula | C23H26F2N2O2 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 6-[4-[4-(3,4-difluorophenyl)butylamino]cyclohexyl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2ccc(C3CCC(NCCCCc4ccc(F)c(F)c4)CC3)cc2o1 |
| InChI | InChI=1S/C23H26F2N2O2/c24-19-10-4-15(13-20(19)25)3-1-2-12-26-18-8-5-16(6-9-18)17-7-11-21-22(14-17)29-23(28)27-21/h4,7,10-11,13-14,16,18,26H,1-3,5-6,8-9,12H2,(H,27,28) |
| InChIKey | XDQVZLUAOPHEGT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|