C26H33FN2O2S — CID 142099367
(E)-but-2-ene-2-thiol;6-[4-[3-(4-fluorophenyl)propylamino]cyclohexyl]-3H-1,3-benzoxazol-2-one (PubChem CID 142099367) has the molecular formula C26H33FN2O2S and a molecular weight of 456.63 g/mol. Its IUPAC name is (E)-but-2-ene-2-thiol;6-[4-[3-(4-fluorophenyl)propylamino]cyclohexyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | (E)-but-2-ene-2-thiol;6-[4-[3-(4-fluorophenyl)propylamino]cyclohexyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 142099367 |
| Molecular Formula | C26H33FN2O2S |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | (E)-but-2-ene-2-thiol;6-[4-[3-(4-fluorophenyl)propylamino]cyclohexyl]-3H-1,3-benzoxazol-2-one |
| SMILES | C/C=C(\C)S.O=c1[nH]c2ccc(C3CCC(NCCCc4ccc(F)cc4)CC3)cc2o1 |
| InChI | InChI=1S/C22H25FN2O2.C4H8S/c23-18-8-3-15(4-9-18)2-1-13-24-19-10-5-16(6-11-19)17-7-12-20-21(14-17)27-22(26)25-20;1-3-4(2)5/h3-4,7-9,12,14,16,19,24H,1-2,5-6,10-11,13H2,(H,25,26);3,5H,1-2H3/b;4-3+ |
| InChIKey | HSKZIJNEIKCBEB-SCBDLNNBSA-N |
| XLogP | 6.35 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|