C11H12N2O2 — CID 82491853
6-[(cyclopropylamino)methyl]-3H-1,3-benzoxazol-2-one (PubChem CID 82491853) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 6-[(cyclopropylamino)methyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[(cyclopropylamino)methyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 82491853 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 6-[(cyclopropylamino)methyl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2ccc(CNC3CC3)cc2o1 |
| InChI | InChI=1S/C11H12N2O2/c14-11-13-9-4-1-7(5-10(9)15-11)6-12-8-2-3-8/h1,4-5,8,12H,2-3,6H2,(H,13,14) |
| InChIKey | RTFSPXOSFBEXON-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |