C17H24N2O2 — CID 110799856
1-[4-[2-(3,4-dimethylphenyl)acetyl]piperazin-1-yl]propan-1-one (PubChem CID 110799856) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-[4-[2-(3,4-dimethylphenyl)acetyl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-[2-(3,4-dimethylphenyl)acetyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 110799856 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-[4-[2-(3,4-dimethylphenyl)acetyl]piperazin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCN(C(=O)Cc2ccc(C)c(C)c2)CC1 |
| InChI | InChI=1S/C17H24N2O2/c1-4-16(20)18-7-9-19(10-8-18)17(21)12-15-6-5-13(2)14(3)11-15/h5-6,11H,4,7-10,12H2,1-3H3 |
| InChIKey | BYKPHLFRUFXGOU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |