C20H30N2O2 — CID 110806763
1-[4-[2-(3,4-dimethylphenyl)acetyl]-1,4-diazepan-1-yl]pentan-1-one (PubChem CID 110806763) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 1-[4-[2-(3,4-dimethylphenyl)acetyl]-1,4-diazepan-1-yl]pentan-1-one.
| Compound Name | 1-[4-[2-(3,4-dimethylphenyl)acetyl]-1,4-diazepan-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 110806763 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 1-[4-[2-(3,4-dimethylphenyl)acetyl]-1,4-diazepan-1-yl]pentan-1-one |
| SMILES | CCCCC(=O)N1CCCN(C(=O)Cc2ccc(C)c(C)c2)CC1 |
| InChI | InChI=1S/C20H30N2O2/c1-4-5-7-19(23)21-10-6-11-22(13-12-21)20(24)15-18-9-8-16(2)17(3)14-18/h8-9,14H,4-7,10-13,15H2,1-3H3 |
| InChIKey | ACRFGOYDWHUADY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |