C16H22N2O3 — CID 110803264
methyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate (PubChem CID 110803264) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is methyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate.
| Compound Name | methyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110803264 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | methyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(C(=O)c2c(C)cc(C)cc2C)CC1 |
| InChI | InChI=1S/C16H22N2O3/c1-11-9-12(2)14(13(3)10-11)15(19)17-5-7-18(8-6-17)16(20)21-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | UZBVVXUBURYRQM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |