methyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate

C16H22N2O3 — CID 110803264

IUPACmethyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate
SMILESCOC(=O)N1CCN(C(=O)c2c(C)cc(C)cc2C)CC1
InChIInChI=1S/C16H22N2O3/c1-11-9-12(2)14(13(3)10-11)15(19)17-5-7-18(8-6-17)16(20)21-4/h9-10H,5-8H2,1-4H3
InChIKeyUZBVVXUBURYRQM-UHFFFAOYSA-N
MW290.36 g/mol
LogP2.14
Rot. Bonds1

About methyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate

methyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate (PubChem CID 110803264) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is methyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate.

Molecular Properties

Compound Namemethyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate
PubChem CID110803264
Molecular FormulaC16H22N2O3
Molecular Weight290.36 g/mol
Exact Mass290.16
IUPAC Namemethyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate
SMILESCOC(=O)N1CCN(C(=O)c2c(C)cc(C)cc2C)CC1
InChIInChI=1S/C16H22N2O3/c1-11-9-12(2)14(13(3)10-11)15(19)17-5-7-18(8-6-17)16(20)21-4/h9-10H,5-8H2,1-4H3
InChIKeyUZBVVXUBURYRQM-UHFFFAOYSA-N
XLogP2.14
TPSA49.85 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.36
LogP ≤ 52.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate?
The IUPAC name of methyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate (CID 110803264) is methyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate.
What is the SMILES notation for methyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate?
The canonical SMILES for methyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate is COC(=O)N1CCN(C(=O)c2c(C)cc(C)cc2C)CC1.
What is the InChIKey of methyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate?
The InChIKey is UZBVVXUBURYRQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O3/c1-11-9-12(2)14(13(3)10-11)15(19)17-5-7-18(8-6-17)16(20)21-4/h9-10H,5-8H2,1-4H3.
What are the key properties of methyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate?
methyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate has a molecular weight of 290.36 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2,4,6-trimethylbenzoyl)piperazine-1-carboxylate is sourced from PubChem (CID 110803264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).