C15H25NO4 — CID 11080360
tert-butyl N-[(2R,3S,5E,7E)-3-methoxy-9-oxonona-5,7-dien-2-yl]carbamate (PubChem CID 11080360) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S,5E,7E)-3-methoxy-9-oxonona-5,7-dien-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S,5E,7E)-3-methoxy-9-oxonona-5,7-dien-2-yl]carbamate |
|---|---|
| PubChem CID | 11080360 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | tert-butyl N-[(2R,3S,5E,7E)-3-methoxy-9-oxonona-5,7-dien-2-yl]carbamate |
| SMILES | CO[C@@H](C/C=C/C=C/C=O)[C@@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25NO4/c1-12(16-14(18)20-15(2,3)4)13(19-5)10-8-6-7-9-11-17/h6-9,11-13H,10H2,1-5H3,(H,16,18)/b8-6+,9-7+/t12-,13+/m1/s1 |
| InChIKey | AULLSWRNISDACM-YEENXQQXSA-N |
| XLogP | 2.62 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|