C20H37NO3 — CID 101042102
tert-butyl N-[(2S,3R,5E,7E)-3-methoxytetradeca-5,7-dien-2-yl]carbamate (PubChem CID 101042102) has the molecular formula C20H37NO3 and a molecular weight of 339.52 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R,5E,7E)-3-methoxytetradeca-5,7-dien-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R,5E,7E)-3-methoxytetradeca-5,7-dien-2-yl]carbamate |
|---|---|
| PubChem CID | 101042102 |
| Molecular Formula | C20H37NO3 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | tert-butyl N-[(2S,3R,5E,7E)-3-methoxytetradeca-5,7-dien-2-yl]carbamate |
| SMILES | CCCCCC/C=C/C=C/C[C@@H](OC)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H37NO3/c1-7-8-9-10-11-12-13-14-15-16-18(23-6)17(2)21-19(22)24-20(3,4)5/h12-15,17-18H,7-11,16H2,1-6H3,(H,21,22)/b13-12+,15-14+/t17-,18+/m0/s1 |
| InChIKey | LJGOJCQRPWZTJS-UUPJVKADSA-N |
| XLogP | 5.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|