C15H23NO3 — CID 142241818
tert-butyl N-[(4Z)-3-methylidene-1-(oxiran-2-yl)hepta-4,6-dienyl]carbamate (PubChem CID 142241818) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is tert-butyl N-[(4Z)-3-methylidene-1-(oxiran-2-yl)hepta-4,6-dienyl]carbamate.
| Compound Name | tert-butyl N-[(4Z)-3-methylidene-1-(oxiran-2-yl)hepta-4,6-dienyl]carbamate |
|---|---|
| PubChem CID | 142241818 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | tert-butyl N-[(4Z)-3-methylidene-1-(oxiran-2-yl)hepta-4,6-dienyl]carbamate |
| SMILES | C=C/C=C\C(=C)CC(NC(=O)OC(C)(C)C)C1CO1 |
| InChI | InChI=1S/C15H23NO3/c1-6-7-8-11(2)9-12(13-10-18-13)16-14(17)19-15(3,4)5/h6-8,12-13H,1-2,9-10H2,3-5H3,(H,16,17)/b8-7- |
| InChIKey | PKTOZPFJELIXCL-FPLPWBNLSA-N |
| XLogP | 2.97 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|