C17H24FNO3 — CID 163776497
tert-butyl N-[2-(3-ethenyl-5-fluorocyclohexa-2,4-dien-1-yl)-1-(oxiran-2-yl)ethyl]carbamate (PubChem CID 163776497) has the molecular formula C17H24FNO3 and a molecular weight of 309.38 g/mol. Its IUPAC name is tert-butyl N-[2-(3-ethenyl-5-fluorocyclohexa-2,4-dien-1-yl)-1-(oxiran-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(3-ethenyl-5-fluorocyclohexa-2,4-dien-1-yl)-1-(oxiran-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 163776497 |
| Molecular Formula | C17H24FNO3 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | tert-butyl N-[2-(3-ethenyl-5-fluorocyclohexa-2,4-dien-1-yl)-1-(oxiran-2-yl)ethyl]carbamate |
| SMILES | C=CC1=CC(CC(NC(=O)OC(C)(C)C)C2CO2)CC(F)=C1 |
| InChI | InChI=1S/C17H24FNO3/c1-5-11-6-12(8-13(18)7-11)9-14(15-10-21-15)19-16(20)22-17(2,3)4/h5-7,12,14-15H,1,8-10H2,2-4H3,(H,19,20) |
| InChIKey | MKXWWQJOGWBBHC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|