C12H21NO3 — CID 11831161
tert-butyl N-[(1S)-3-methyl-1-[(2R)-oxiran-2-yl]but-2-enyl]carbamate (PubChem CID 11831161) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is tert-butyl N-[(1S)-3-methyl-1-[(2R)-oxiran-2-yl]but-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-3-methyl-1-[(2R)-oxiran-2-yl]but-2-enyl]carbamate |
|---|---|
| PubChem CID | 11831161 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | tert-butyl N-[(1S)-3-methyl-1-[(2R)-oxiran-2-yl]but-2-enyl]carbamate |
| SMILES | CC(C)=C[C@H](NC(=O)OC(C)(C)C)[C@@H]1CO1 |
| InChI | InChI=1S/C12H21NO3/c1-8(2)6-9(10-7-15-10)13-11(14)16-12(3,4)5/h6,9-10H,7H2,1-5H3,(H,13,14)/t9-,10-/m0/s1 |
| InChIKey | IQBJMQYLHSMINX-UWVGGRQHSA-N |
| XLogP | 2.24 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|