C12H17NO2 — CID 142132034
4-[(3Z,5Z)-3-ethenylhepta-3,5-dienyl]-1,3-oxazolidin-2-one (PubChem CID 142132034) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 4-[(3Z,5Z)-3-ethenylhepta-3,5-dienyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-[(3Z,5Z)-3-ethenylhepta-3,5-dienyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 142132034 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 4-[(3Z,5Z)-3-ethenylhepta-3,5-dienyl]-1,3-oxazolidin-2-one |
| SMILES | C=C/C(=C\C=C/C)CCC1COC(=O)N1 |
| InChI | InChI=1S/C12H17NO2/c1-3-5-6-10(4-2)7-8-11-9-15-12(14)13-11/h3-6,11H,2,7-9H2,1H3,(H,13,14)/b5-3-,10-6+ |
| InChIKey | XKHLLFKFBSJKQE-UTMABKKZSA-N |
| XLogP | 2.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|