C10H13NO2 — CID 123701505
4-(cyclohexa-1,3-dien-1-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 123701505) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 4-(cyclohexa-1,3-dien-1-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | 4-(cyclohexa-1,3-dien-1-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 123701505 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 4-(cyclohexa-1,3-dien-1-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(CC2=CC=CCC2)CO1 |
| InChI | InChI=1S/C10H13NO2/c12-10-11-9(7-13-10)6-8-4-2-1-3-5-8/h1-2,4,9H,3,5-7H2,(H,11,12) |
| InChIKey | BOJKRWREYHCHQP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |