C12H17NO2 — CID 78076799
4-cycloocta-2,4-dien-1-yl-5-methyl-1,3-oxazolidin-2-one (PubChem CID 78076799) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 4-cycloocta-2,4-dien-1-yl-5-methyl-1,3-oxazolidin-2-one.
| Compound Name | 4-cycloocta-2,4-dien-1-yl-5-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 78076799 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 4-cycloocta-2,4-dien-1-yl-5-methyl-1,3-oxazolidin-2-one |
| SMILES | CC1OC(=O)NC1C1C=CC=CCCC1 |
| InChI | InChI=1S/C12H17NO2/c1-9-11(13-12(14)15-9)10-7-5-3-2-4-6-8-10/h2-3,5,7,9-11H,4,6,8H2,1H3,(H,13,14) |
| InChIKey | SOBQYMIMVNSGHZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |