C9H11NO2 — CID 123952437
4-cyclohexa-2,4-dien-1-yl-1,3-oxazolidin-2-one (PubChem CID 123952437) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 4-cyclohexa-2,4-dien-1-yl-1,3-oxazolidin-2-one.
| Compound Name | 4-cyclohexa-2,4-dien-1-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 123952437 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 4-cyclohexa-2,4-dien-1-yl-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(C2C=CC=CC2)CO1 |
| InChI | InChI=1S/C9H11NO2/c11-9-10-8(6-12-9)7-4-2-1-3-5-7/h1-4,7-8H,5-6H2,(H,10,11) |
| InChIKey | KLOMSPAAEACJEO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |