C9H13NO2 — CID 123363079
4-hexa-2,4-dien-3-yl-1,3-oxazolidin-2-one (PubChem CID 123363079) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 4-hexa-2,4-dien-3-yl-1,3-oxazolidin-2-one.
| Compound Name | 4-hexa-2,4-dien-3-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 123363079 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 4-hexa-2,4-dien-3-yl-1,3-oxazolidin-2-one |
| SMILES | CC=CC(=CC)C1COC(=O)N1 |
| InChI | InChI=1S/C9H13NO2/c1-3-5-7(4-2)8-6-12-9(11)10-8/h3-5,8H,6H2,1-2H3,(H,10,11) |
| InChIKey | VHONURZARGKBGO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|