C6H9NO2 — CID 14840510
4-[(E)-prop-1-enyl]-1,3-oxazolidin-2-one (PubChem CID 14840510) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is 4-[(E)-prop-1-enyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-[(E)-prop-1-enyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 14840510 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 4-[(E)-prop-1-enyl]-1,3-oxazolidin-2-one |
| SMILES | C/C=C/C1COC(=O)N1 |
| InChI | InChI=1S/C6H9NO2/c1-2-3-5-4-9-6(8)7-5/h2-3,5H,4H2,1H3,(H,7,8)/b3-2+ |
| InChIKey | RTDDMMHMIAPRRG-NSCUHMNNSA-N |
| XLogP | 0.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|