C8H14NO3P — CID 23405613
4-[(E)-3-dimethylphosphorylprop-1-enyl]-1,3-oxazolidin-2-one (PubChem CID 23405613) has the molecular formula C8H14NO3P and a molecular weight of 203.18 g/mol. Its IUPAC name is 4-[(E)-3-dimethylphosphorylprop-1-enyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-[(E)-3-dimethylphosphorylprop-1-enyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 23405613 |
| Molecular Formula | C8H14NO3P |
| Molecular Weight | 203.18 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 4-[(E)-3-dimethylphosphorylprop-1-enyl]-1,3-oxazolidin-2-one |
| SMILES | CP(C)(=O)C/C=C/C1COC(=O)N1 |
| InChI | InChI=1S/C8H14NO3P/c1-13(2,11)5-3-4-7-6-12-8(10)9-7/h3-4,7H,5-6H2,1-2H3,(H,9,10)/b4-3+ |
| InChIKey | GWYRNMPCJJXIEP-ONEGZZNKSA-N |
| XLogP | 1.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.18 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|