C5H7NO2 — CID 14982204
4-ethenyl-1,3-oxazolidin-2-one (PubChem CID 14982204) has the molecular formula C5H7NO2 and a molecular weight of 113.12 g/mol. Its IUPAC name is 4-ethenyl-1,3-oxazolidin-2-one.
| Compound Name | 4-ethenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 14982204 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.05 |
| IUPAC Name | 4-ethenyl-1,3-oxazolidin-2-one |
| SMILES | C=CC1COC(=O)N1 |
| InChI | InChI=1S/C5H7NO2/c1-2-4-3-8-5(7)6-4/h2,4H,1,3H2,(H,6,7) |
| InChIKey | WRQDRNWXVRNPFT-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|