C7H9NO2 — CID 14941759
(4R)-4-buta-2,3-dienyl-1,3-oxazolidin-2-one (PubChem CID 14941759) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is (4R)-4-buta-2,3-dienyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-buta-2,3-dienyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 14941759 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | (4R)-4-buta-2,3-dienyl-1,3-oxazolidin-2-one |
| SMILES | C=C=CC[C@@H]1COC(=O)N1 |
| InChI | InChI=1S/C7H9NO2/c1-2-3-4-6-5-10-7(9)8-6/h3,6H,1,4-5H2,(H,8,9)/t6-/m1/s1 |
| InChIKey | ARAYTXKRBVLNPZ-ZCFIWIBFSA-N |
| XLogP | 0.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |