C18H31NO3 — CID 14235833
[(2S,3R,5E,7E)-2-acetamidotetradeca-5,7-dien-3-yl] acetate (PubChem CID 14235833) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is [(2S,3R,5E,7E)-2-acetamidotetradeca-5,7-dien-3-yl] acetate.
| Compound Name | [(2S,3R,5E,7E)-2-acetamidotetradeca-5,7-dien-3-yl] acetate |
|---|---|
| PubChem CID | 14235833 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | [(2S,3R,5E,7E)-2-acetamidotetradeca-5,7-dien-3-yl] acetate |
| SMILES | CCCCCC/C=C/C=C/C[C@@H](OC(C)=O)[C@H](C)NC(C)=O |
| InChI | InChI=1S/C18H31NO3/c1-5-6-7-8-9-10-11-12-13-14-18(22-17(4)21)15(2)19-16(3)20/h10-13,15,18H,5-9,14H2,1-4H3,(H,19,20)/b11-10+,13-12+/t15-,18+/m0/s1 |
| InChIKey | ZWXSLXKTWCAPAN-GKLUGRAFSA-N |
| XLogP | 3.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|