C20H35NO5 — CID 10642857
[(Z,2R,3R)-2-acetamido-3-acetyloxytetradec-7-enyl] acetate (PubChem CID 10642857) has the molecular formula C20H35NO5 and a molecular weight of 369.50 g/mol. Its IUPAC name is [(Z,2R,3R)-2-acetamido-3-acetyloxytetradec-7-enyl] acetate.
| Compound Name | [(Z,2R,3R)-2-acetamido-3-acetyloxytetradec-7-enyl] acetate |
|---|---|
| PubChem CID | 10642857 |
| Molecular Formula | C20H35NO5 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | [(Z,2R,3R)-2-acetamido-3-acetyloxytetradec-7-enyl] acetate |
| SMILES | CCCCCC/C=C\CCC[C@@H](OC(C)=O)[C@@H](COC(C)=O)NC(C)=O |
| InChI | InChI=1S/C20H35NO5/c1-5-6-7-8-9-10-11-12-13-14-20(26-18(4)24)19(21-16(2)22)15-25-17(3)23/h10-11,19-20H,5-9,12-15H2,1-4H3,(H,21,22)/b11-10-/t19-,20-/m1/s1 |
| InChIKey | GYDLFIIEGSZHLA-RAKWIPDMSA-N |
| XLogP | 3.68 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|