C18H33NO3 — CID 10968962
[(2S,3R)-2-acetamidotetradec-13-en-3-yl] acetate (PubChem CID 10968962) has the molecular formula C18H33NO3 and a molecular weight of 311.47 g/mol. Its IUPAC name is [(2S,3R)-2-acetamidotetradec-13-en-3-yl] acetate.
| Compound Name | [(2S,3R)-2-acetamidotetradec-13-en-3-yl] acetate |
|---|---|
| PubChem CID | 10968962 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | [(2S,3R)-2-acetamidotetradec-13-en-3-yl] acetate |
| SMILES | C=CCCCCCCCCC[C@@H](OC(C)=O)[C@H](C)NC(C)=O |
| InChI | InChI=1S/C18H33NO3/c1-5-6-7-8-9-10-11-12-13-14-18(22-17(4)21)15(2)19-16(3)20/h5,15,18H,1,6-14H2,2-4H3,(H,19,20)/t15-,18+/m0/s1 |
| InChIKey | HKCVQKQNBZLFNI-MAUKXSAKSA-N |
| XLogP | 4.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|