C18H33NO2 — CID 143364378
tert-butyl N-[(7Z)-6-methylidenedeca-7,9-dien-4-yl]carbamate;ethane (PubChem CID 143364378) has the molecular formula C18H33NO2 and a molecular weight of 295.47 g/mol. Its IUPAC name is tert-butyl N-[(7Z)-6-methylidenedeca-7,9-dien-4-yl]carbamate;ethane.
| Compound Name | tert-butyl N-[(7Z)-6-methylidenedeca-7,9-dien-4-yl]carbamate;ethane |
|---|---|
| PubChem CID | 143364378 |
| Molecular Formula | C18H33NO2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | tert-butyl N-[(7Z)-6-methylidenedeca-7,9-dien-4-yl]carbamate;ethane |
| SMILES | C=C/C=C\C(=C)CC(CCC)NC(=O)OC(C)(C)C.CC |
| InChI | InChI=1S/C16H27NO2.C2H6/c1-7-9-11-13(3)12-14(10-8-2)17-15(18)19-16(4,5)6;1-2/h7,9,11,14H,1,3,8,10,12H2,2,4-6H3,(H,17,18);1-2H3/b11-9-; |
| InChIKey | FZHYZZYNWAAZIQ-KSIDEHCFSA-N |
| XLogP | 5.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|