C17H21N3O4 — CID 110805560
6-(4-acetyl-1,4-diazepane-1-carbonyl)-2-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 110805560) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 6-(4-acetyl-1,4-diazepane-1-carbonyl)-2-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(4-acetyl-1,4-diazepane-1-carbonyl)-2-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 110805560 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 6-(4-acetyl-1,4-diazepane-1-carbonyl)-2-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC(=O)N1CCCN(C(=O)c2ccc3c(c2)NC(=O)C(C)O3)CC1 |
| InChI | InChI=1S/C17H21N3O4/c1-11-16(22)18-14-10-13(4-5-15(14)24-11)17(23)20-7-3-6-19(8-9-20)12(2)21/h4-5,10-11H,3,6-9H2,1-2H3,(H,18,22) |
| InChIKey | YYNBJIBJBWEEBU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |