C17H24FN3O2 — CID 110811477
N-tert-butyl-4-(3-fluorobenzoyl)-1,4-diazepane-1-carboxamide (PubChem CID 110811477) has the molecular formula C17H24FN3O2 and a molecular weight of 321.40 g/mol. Its IUPAC name is N-tert-butyl-4-(3-fluorobenzoyl)-1,4-diazepane-1-carboxamide.
| Compound Name | N-tert-butyl-4-(3-fluorobenzoyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 110811477 |
| Molecular Formula | C17H24FN3O2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | N-tert-butyl-4-(3-fluorobenzoyl)-1,4-diazepane-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CCCN(C(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C17H24FN3O2/c1-17(2,3)19-16(23)21-9-5-8-20(10-11-21)15(22)13-6-4-7-14(18)12-13/h4,6-7,12H,5,8-11H2,1-3H3,(H,19,23) |
| InChIKey | HRYVUJNABMBTQV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |