C16H23N3O5S — CID 110811989
4-(1,3-benzodioxol-5-ylsulfonyl)-N-propyl-1,4-diazepane-1-carboxamide (PubChem CID 110811989) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylsulfonyl)-N-propyl-1,4-diazepane-1-carboxamide.
| Compound Name | 4-(1,3-benzodioxol-5-ylsulfonyl)-N-propyl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 110811989 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylsulfonyl)-N-propyl-1,4-diazepane-1-carboxamide |
| SMILES | CCCNC(=O)N1CCCN(S(=O)(=O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C16H23N3O5S/c1-2-6-17-16(20)18-7-3-8-19(10-9-18)25(21,22)13-4-5-14-15(11-13)24-12-23-14/h4-5,11H,2-3,6-10,12H2,1H3,(H,17,20) |
| InChIKey | AZVUUDDCZGLXJJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |