C15H22ClN3O3S — CID 110812061
4-(2-chlorophenyl)sulfonyl-N-propyl-1,4-diazepane-1-carboxamide (PubChem CID 110812061) has the molecular formula C15H22ClN3O3S and a molecular weight of 359.88 g/mol. Its IUPAC name is 4-(2-chlorophenyl)sulfonyl-N-propyl-1,4-diazepane-1-carboxamide.
| Compound Name | 4-(2-chlorophenyl)sulfonyl-N-propyl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 110812061 |
| Molecular Formula | C15H22ClN3O3S |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 4-(2-chlorophenyl)sulfonyl-N-propyl-1,4-diazepane-1-carboxamide |
| SMILES | CCCNC(=O)N1CCCN(S(=O)(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C15H22ClN3O3S/c1-2-8-17-15(20)18-9-5-10-19(12-11-18)23(21,22)14-7-4-3-6-13(14)16/h3-4,6-7H,2,5,8-12H2,1H3,(H,17,20) |
| InChIKey | KGWULCSLCFZJRR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |