C29H27NO7 — CID 11081633
methyl (2S,3R)-2-[acetyloxy(diphenyl)methyl]-1-[(1S)-2-methoxy-2-oxo-1-phenylethyl]-4-oxoazetidine-3-carboxylate (PubChem CID 11081633) has the molecular formula C29H27NO7 and a molecular weight of 501.54 g/mol. Its IUPAC name is methyl (2S,3R)-2-[acetyloxy(diphenyl)methyl]-1-[(1S)-2-methoxy-2-oxo-1-phenylethyl]-4-oxoazetidine-3-carboxylate.
| Compound Name | methyl (2S,3R)-2-[acetyloxy(diphenyl)methyl]-1-[(1S)-2-methoxy-2-oxo-1-phenylethyl]-4-oxoazetidine-3-carboxylate |
|---|---|
| PubChem CID | 11081633 |
| Molecular Formula | C29H27NO7 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | methyl (2S,3R)-2-[acetyloxy(diphenyl)methyl]-1-[(1S)-2-methoxy-2-oxo-1-phenylethyl]-4-oxoazetidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)N([C@H](C(=O)OC)c2ccccc2)[C@@H]1C(OC(C)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H27NO7/c1-19(31)37-29(21-15-9-5-10-16-21,22-17-11-6-12-18-22)25-23(27(33)35-2)26(32)30(25)24(28(34)36-3)20-13-7-4-8-14-20/h4-18,23-25H,1-3H3/t23-,24+,25+/m1/s1 |
| InChIKey | HACMMHASNOMSBK-DSITVLBTSA-N |
| XLogP | 3.41 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|