C19H23N3O3 — CID 110816545
1-[4-(2-methoxybenzoyl)-1,4-diazepan-1-yl]-2-(1H-pyrrol-3-yl)ethanone (PubChem CID 110816545) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-[4-(2-methoxybenzoyl)-1,4-diazepan-1-yl]-2-(1H-pyrrol-3-yl)ethanone.
| Compound Name | 1-[4-(2-methoxybenzoyl)-1,4-diazepan-1-yl]-2-(1H-pyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 110816545 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-[4-(2-methoxybenzoyl)-1,4-diazepan-1-yl]-2-(1H-pyrrol-3-yl)ethanone |
| SMILES | COc1ccccc1C(=O)N1CCCN(C(=O)Cc2cc[nH]c2)CC1 |
| InChI | InChI=1S/C19H23N3O3/c1-25-17-6-3-2-5-16(17)19(24)22-10-4-9-21(11-12-22)18(23)13-15-7-8-20-14-15/h2-3,5-8,14,20H,4,9-13H2,1H3 |
| InChIKey | AQAIGMUZJKKSGE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |