C16H21N3O5S — CID 110817095
6-(4-acetylpiperazin-1-yl)sulfonyl-2,4-dimethyl-1,4-benzoxazin-3-one (PubChem CID 110817095) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is 6-(4-acetylpiperazin-1-yl)sulfonyl-2,4-dimethyl-1,4-benzoxazin-3-one.
| Compound Name | 6-(4-acetylpiperazin-1-yl)sulfonyl-2,4-dimethyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 110817095 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 6-(4-acetylpiperazin-1-yl)sulfonyl-2,4-dimethyl-1,4-benzoxazin-3-one |
| SMILES | CC(=O)N1CCN(S(=O)(=O)c2ccc3c(c2)N(C)C(=O)C(C)O3)CC1 |
| InChI | InChI=1S/C16H21N3O5S/c1-11-16(21)17(3)14-10-13(4-5-15(14)24-11)25(22,23)19-8-6-18(7-9-19)12(2)20/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | GDDQYRNWKVIVKJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |