C15H22N2O6S — CID 110817100
1-[4-(2,4,6-trimethoxyphenyl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 110817100) has the molecular formula C15H22N2O6S and a molecular weight of 358.42 g/mol. Its IUPAC name is 1-[4-(2,4,6-trimethoxyphenyl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 1-[4-(2,4,6-trimethoxyphenyl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 110817100 |
| Molecular Formula | C15H22N2O6S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 1-[4-(2,4,6-trimethoxyphenyl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | COc1cc(OC)c(S(=O)(=O)N2CCN(C(C)=O)CC2)c(OC)c1 |
| InChI | InChI=1S/C15H22N2O6S/c1-11(18)16-5-7-17(8-6-16)24(19,20)15-13(22-3)9-12(21-2)10-14(15)23-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | AQQUICWLSUWXEQ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |