C17H33N3O2 — CID 110820103
1-(2,2-dimethylpropyl)-3-[1-(2-ethylbutanoyl)piperidin-4-yl]urea (PubChem CID 110820103) has the molecular formula C17H33N3O2 and a molecular weight of 311.47 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-3-[1-(2-ethylbutanoyl)piperidin-4-yl]urea.
| Compound Name | 1-(2,2-dimethylpropyl)-3-[1-(2-ethylbutanoyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 110820103 |
| Molecular Formula | C17H33N3O2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-3-[1-(2-ethylbutanoyl)piperidin-4-yl]urea |
| SMILES | CCC(CC)C(=O)N1CCC(NC(=O)NCC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H33N3O2/c1-6-13(7-2)15(21)20-10-8-14(9-11-20)19-16(22)18-12-17(3,4)5/h13-14H,6-12H2,1-5H3,(H2,18,19,22) |
| InChIKey | QAALEXLGHOFPFO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |