C14H25ClN2O3 — CID 108566162
2-chloroethyl N-[1-(2-ethylbutanoyl)piperidin-4-yl]carbamate (PubChem CID 108566162) has the molecular formula C14H25ClN2O3 and a molecular weight of 304.82 g/mol. Its IUPAC name is 2-chloroethyl N-[1-(2-ethylbutanoyl)piperidin-4-yl]carbamate.
| Compound Name | 2-chloroethyl N-[1-(2-ethylbutanoyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 108566162 |
| Molecular Formula | C14H25ClN2O3 |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-chloroethyl N-[1-(2-ethylbutanoyl)piperidin-4-yl]carbamate |
| SMILES | CCC(CC)C(=O)N1CCC(NC(=O)OCCCl)CC1 |
| InChI | InChI=1S/C14H25ClN2O3/c1-3-11(4-2)13(18)17-8-5-12(6-9-17)16-14(19)20-10-7-15/h11-12H,3-10H2,1-2H3,(H,16,19) |
| InChIKey | XTGCDKRPIVHPIM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|