C17H23ClN2O5 — CID 108563826
2-chloroethyl N-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]carbamate (PubChem CID 108563826) has the molecular formula C17H23ClN2O5 and a molecular weight of 370.83 g/mol. Its IUPAC name is 2-chloroethyl N-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]carbamate.
| Compound Name | 2-chloroethyl N-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 108563826 |
| Molecular Formula | C17H23ClN2O5 |
| Molecular Weight | 370.83 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-chloroethyl N-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]carbamate |
| SMILES | COc1cccc(OC)c1C(=O)N1CCC(NC(=O)OCCCl)CC1 |
| InChI | InChI=1S/C17H23ClN2O5/c1-23-13-4-3-5-14(24-2)15(13)16(21)20-9-6-12(7-10-20)19-17(22)25-11-8-18/h3-5,12H,6-11H2,1-2H3,(H,19,22) |
| InChIKey | XXXSILATMXJKRP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.83 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|