C15H19N3O4 — CID 110821316
N-[1-(5-oxopyrrolidine-2-carbonyl)piperidin-4-yl]furan-2-carboxamide (PubChem CID 110821316) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is N-[1-(5-oxopyrrolidine-2-carbonyl)piperidin-4-yl]furan-2-carboxamide.
| Compound Name | N-[1-(5-oxopyrrolidine-2-carbonyl)piperidin-4-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 110821316 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-[1-(5-oxopyrrolidine-2-carbonyl)piperidin-4-yl]furan-2-carboxamide |
| SMILES | O=C1CCC(C(=O)N2CCC(NC(=O)c3ccco3)CC2)N1 |
| InChI | InChI=1S/C15H19N3O4/c19-13-4-3-11(17-13)15(21)18-7-5-10(6-8-18)16-14(20)12-2-1-9-22-12/h1-2,9-11H,3-8H2,(H,16,20)(H,17,19) |
| InChIKey | CJETVHUUUICYHJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |