C31H40N6O4 — CID 11082276
benzyl (2S)-2-[[(2S)-2-(cyclohexanecarbonylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 11082276) has the molecular formula C31H40N6O4 and a molecular weight of 560.70 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-2-(cyclohexanecarbonylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-2-(cyclohexanecarbonylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 11082276 |
| Molecular Formula | C31H40N6O4 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-2-(cyclohexanecarbonylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | NC(N)=NCCC[C@H](NC(=O)C1CCCCC1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H40N6O4/c32-31(33)34-17-9-16-26(36-28(38)22-12-5-2-6-13-22)29(39)37-27(30(40)41-20-21-10-3-1-4-11-21)18-23-19-35-25-15-8-7-14-24(23)25/h1,3-4,7-8,10-11,14-15,19,22,26-27,35H,2,5-6,9,12-13,16-18,20H2,(H,36,38)(H,37,39)(H4,32,33,34)/t26-,27-/m0/s1 |
| InChIKey | XDMLTXRFNAMMEN-SVBPBHIXSA-N |
| XLogP | 3.06 |
| TPSA | 164.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|