C17H16ClNO4 — CID 110823924
2-(3-chloro-4-methoxyanilino)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanone (PubChem CID 110823924) has the molecular formula C17H16ClNO4 and a molecular weight of 333.77 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyanilino)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanone.
| Compound Name | 2-(3-chloro-4-methoxyanilino)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanone |
|---|---|
| PubChem CID | 110823924 |
| Molecular Formula | C17H16ClNO4 |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2-(3-chloro-4-methoxyanilino)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanone |
| SMILES | COc1ccc(NCC(=O)c2ccc3c(c2)OCCO3)cc1Cl |
| InChI | InChI=1S/C17H16ClNO4/c1-21-15-5-3-12(9-13(15)18)19-10-14(20)11-2-4-16-17(8-11)23-7-6-22-16/h2-5,8-9,19H,6-7,10H2,1H3 |
| InChIKey | SOUWJEUJHMIFLE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|