C20H26N2O5S — CID 110823983
4-[2-(2,4-dimethoxyanilino)acetyl]-N,N-diethylbenzenesulfonamide (PubChem CID 110823983) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is 4-[2-(2,4-dimethoxyanilino)acetyl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[2-(2,4-dimethoxyanilino)acetyl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 110823983 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 4-[2-(2,4-dimethoxyanilino)acetyl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)CNc2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C20H26N2O5S/c1-5-22(6-2)28(24,25)17-10-7-15(8-11-17)19(23)14-21-18-12-9-16(26-3)13-20(18)27-4/h7-13,21H,5-6,14H2,1-4H3 |
| InChIKey | XHKBHPSXBKZRLC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|