C20H26N2O2S — CID 110827326
N-[(2-methylphenyl)methyl]-4-(2-methylpiperidin-1-yl)sulfonylaniline (PubChem CID 110827326) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is N-[(2-methylphenyl)methyl]-4-(2-methylpiperidin-1-yl)sulfonylaniline.
| Compound Name | N-[(2-methylphenyl)methyl]-4-(2-methylpiperidin-1-yl)sulfonylaniline |
|---|---|
| PubChem CID | 110827326 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-[(2-methylphenyl)methyl]-4-(2-methylpiperidin-1-yl)sulfonylaniline |
| SMILES | Cc1ccccc1CNc1ccc(S(=O)(=O)N2CCCCC2C)cc1 |
| InChI | InChI=1S/C20H26N2O2S/c1-16-7-3-4-9-18(16)15-21-19-10-12-20(13-11-19)25(23,24)22-14-6-5-8-17(22)2/h3-4,7,9-13,17,21H,5-6,8,14-15H2,1-2H3 |
| InChIKey | KOWYXGZLTJPOPG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |