C19H25FN2OS — CID 110830545
2-[[2-(diethylamino)-2-thiophen-2-ylethyl]amino]-1-(3-fluoro-4-methylphenyl)ethanone (PubChem CID 110830545) has the molecular formula C19H25FN2OS and a molecular weight of 348.49 g/mol. Its IUPAC name is 2-[[2-(diethylamino)-2-thiophen-2-ylethyl]amino]-1-(3-fluoro-4-methylphenyl)ethanone.
| Compound Name | 2-[[2-(diethylamino)-2-thiophen-2-ylethyl]amino]-1-(3-fluoro-4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 110830545 |
| Molecular Formula | C19H25FN2OS |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-[[2-(diethylamino)-2-thiophen-2-ylethyl]amino]-1-(3-fluoro-4-methylphenyl)ethanone |
| SMILES | CCN(CC)C(CNCC(=O)c1ccc(C)c(F)c1)c1cccs1 |
| InChI | InChI=1S/C19H25FN2OS/c1-4-22(5-2)17(19-7-6-10-24-19)12-21-13-18(23)15-9-8-14(3)16(20)11-15/h6-11,17,21H,4-5,12-13H2,1-3H3 |
| InChIKey | JKQPXEKUGYQBAZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |