C17H20ClFN2OS — CID 112503956
2-chloro-N-[2-(diethylamino)-2-thiophen-2-ylethyl]-6-fluorobenzamide (PubChem CID 112503956) has the molecular formula C17H20ClFN2OS and a molecular weight of 354.88 g/mol. Its IUPAC name is 2-chloro-N-[2-(diethylamino)-2-thiophen-2-ylethyl]-6-fluorobenzamide.
| Compound Name | 2-chloro-N-[2-(diethylamino)-2-thiophen-2-ylethyl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 112503956 |
| Molecular Formula | C17H20ClFN2OS |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 2-chloro-N-[2-(diethylamino)-2-thiophen-2-ylethyl]-6-fluorobenzamide |
| SMILES | CCN(CC)C(CNC(=O)c1c(F)cccc1Cl)c1cccs1 |
| InChI | InChI=1S/C17H20ClFN2OS/c1-3-21(4-2)14(15-9-6-10-23-15)11-20-17(22)16-12(18)7-5-8-13(16)19/h5-10,14H,3-4,11H2,1-2H3,(H,20,22) |
| InChIKey | XODJHVRTBLKKKV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |