C17H24N2O2S — CID 110830821
5-[(dipropylamino)methyl]-4-(3-methoxyphenyl)-3H-1,3-thiazol-2-one (PubChem CID 110830821) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is 5-[(dipropylamino)methyl]-4-(3-methoxyphenyl)-3H-1,3-thiazol-2-one.
| Compound Name | 5-[(dipropylamino)methyl]-4-(3-methoxyphenyl)-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 110830821 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 5-[(dipropylamino)methyl]-4-(3-methoxyphenyl)-3H-1,3-thiazol-2-one |
| SMILES | CCCN(CCC)Cc1sc(=O)[nH]c1-c1cccc(OC)c1 |
| InChI | InChI=1S/C17H24N2O2S/c1-4-9-19(10-5-2)12-15-16(18-17(20)22-15)13-7-6-8-14(11-13)21-3/h6-8,11H,4-5,9-10,12H2,1-3H3,(H,18,20) |
| InChIKey | XNEKZLAVMCGSEW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |