C16H15N5O6 — CID 110831553
2-(6-amino-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 110831553) has the molecular formula C16H15N5O6 and a molecular weight of 373.33 g/mol. Its IUPAC name is 2-(6-amino-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-(6-amino-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 110831553 |
| Molecular Formula | C16H15N5O6 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 2-(6-amino-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2C(=O)COc3ccc(N)nc32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H15N5O6/c1-26-9-2-3-10(11(6-9)21(24)25)18-14(22)7-20-15(23)8-27-12-4-5-13(17)19-16(12)20/h2-6H,7-8H2,1H3,(H2,17,19)(H,18,22) |
| InChIKey | APCLFVFUCFFLJW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 149.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|