C21H22N4O5 — CID 110831780
4-[2-(azepan-1-yl)-2-oxoethyl]-6-nitro-2-phenylpyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 110831780) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is 4-[2-(azepan-1-yl)-2-oxoethyl]-6-nitro-2-phenylpyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 4-[2-(azepan-1-yl)-2-oxoethyl]-6-nitro-2-phenylpyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 110831780 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 4-[2-(azepan-1-yl)-2-oxoethyl]-6-nitro-2-phenylpyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | O=C(CN1C(=O)C(c2ccccc2)Oc2ccc([N+](=O)[O-])nc21)N1CCCCCC1 |
| InChI | InChI=1S/C21H22N4O5/c26-18(23-12-6-1-2-7-13-23)14-24-20-16(10-11-17(22-20)25(28)29)30-19(21(24)27)15-8-4-3-5-9-15/h3-5,8-11,19H,1-2,6-7,12-14H2 |
| InChIKey | QOLQNKNGRYVAQU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 105.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|