C16H15N5O7S — CID 110831873
2-(2-methyl-6-nitro-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)-N-(4-sulfamoylphenyl)acetamide (PubChem CID 110831873) has the molecular formula C16H15N5O7S and a molecular weight of 421.39 g/mol. Its IUPAC name is 2-(2-methyl-6-nitro-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-(2-methyl-6-nitro-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 110831873 |
| Molecular Formula | C16H15N5O7S |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 2-(2-methyl-6-nitro-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)-N-(4-sulfamoylphenyl)acetamide |
| SMILES | CC1Oc2ccc([N+](=O)[O-])nc2N(CC(=O)Nc2ccc(S(N)(=O)=O)cc2)C1=O |
| InChI | InChI=1S/C16H15N5O7S/c1-9-16(23)20(15-12(28-9)6-7-13(19-15)21(24)25)8-14(22)18-10-2-4-11(5-3-10)29(17,26)27/h2-7,9H,8H2,1H3,(H,18,22)(H2,17,26,27) |
| InChIKey | AFTWSONPPATYIO-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 174.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|