C20H22N4O7 — CID 110831830
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2-methyl-6-nitro-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide (PubChem CID 110831830) has the molecular formula C20H22N4O7 and a molecular weight of 430.42 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2-methyl-6-nitro-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2-methyl-6-nitro-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 110831830 |
| Molecular Formula | C20H22N4O7 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2-methyl-6-nitro-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide |
| SMILES | COc1ccc(CCNC(=O)CN2C(=O)C(C)Oc3ccc([N+](=O)[O-])nc32)cc1OC |
| InChI | InChI=1S/C20H22N4O7/c1-12-20(26)23(19-15(31-12)6-7-17(22-19)24(27)28)11-18(25)21-9-8-13-4-5-14(29-2)16(10-13)30-3/h4-7,10,12H,8-9,11H2,1-3H3,(H,21,25) |
| InChIKey | REHDHRPSNDPILN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|