C16H16N6O6S — CID 110831860
2-(2-methyl-6-nitro-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)-N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 110831860) has the molecular formula C16H16N6O6S and a molecular weight of 420.41 g/mol. Its IUPAC name is 2-(2-methyl-6-nitro-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)-N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(2-methyl-6-nitro-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)-N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 110831860 |
| Molecular Formula | C16H16N6O6S |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 2-(2-methyl-6-nitro-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)-N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC1Oc2ccc([N+](=O)[O-])nc2N(CC(=O)Nc2nnc(C3CCCO3)s2)C1=O |
| InChI | InChI=1S/C16H16N6O6S/c1-8-15(24)21(13-9(28-8)4-5-11(17-13)22(25)26)7-12(23)18-16-20-19-14(29-16)10-3-2-6-27-10/h4-5,8,10H,2-3,6-7H2,1H3,(H,18,20,23) |
| InChIKey | GFOUVHXGTRIZIV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|