C17H17N5O5 — CID 110831660
2-(6-amino-2-ethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)-N-(3-nitrophenyl)acetamide (PubChem CID 110831660) has the molecular formula C17H17N5O5 and a molecular weight of 371.35 g/mol. Its IUPAC name is 2-(6-amino-2-ethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-(6-amino-2-ethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 110831660 |
| Molecular Formula | C17H17N5O5 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-(6-amino-2-ethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)-N-(3-nitrophenyl)acetamide |
| SMILES | CCC1Oc2ccc(N)nc2N(CC(=O)Nc2cccc([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C17H17N5O5/c1-2-12-17(24)21(16-13(27-12)6-7-14(18)20-16)9-15(23)19-10-4-3-5-11(8-10)22(25)26/h3-8,12H,2,9H2,1H3,(H2,18,20)(H,19,23) |
| InChIKey | DUDOWWLHWXHVDM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 140.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|